C13H21N3O2 — CID 104848503
3-[4-(aminomethyl)-2-methoxyphenyl]-1,1-diethylurea (PubChem CID 104848503) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-2-methoxyphenyl]-1,1-diethylurea.
| Compound Name | 3-[4-(aminomethyl)-2-methoxyphenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 104848503 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3-[4-(aminomethyl)-2-methoxyphenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(CN)cc1OC |
| InChI | InChI=1S/C13H21N3O2/c1-4-16(5-2)13(17)15-11-7-6-10(9-14)8-12(11)18-3/h6-8H,4-5,9,14H2,1-3H3,(H,15,17) |
| InChIKey | QVRPDVFKESSZMG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |