C12H16Br2N2O2 — CID 103412392
3-(2,4-dibromo-5-methoxyphenyl)-1,1-diethylurea (PubChem CID 103412392) has the molecular formula C12H16Br2N2O2 and a molecular weight of 380.08 g/mol. Its IUPAC name is 3-(2,4-dibromo-5-methoxyphenyl)-1,1-diethylurea.
| Compound Name | 3-(2,4-dibromo-5-methoxyphenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 103412392 |
| Molecular Formula | C12H16Br2N2O2 |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 3-(2,4-dibromo-5-methoxyphenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1cc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O2/c1-4-16(5-2)12(17)15-10-7-11(18-3)9(14)6-8(10)13/h6-7H,4-5H2,1-3H3,(H,15,17) |
| InChIKey | BKCUECFJKQVBLQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |