C14H23N3O4 — CID 18006592
1,1-diethyl-3-[2-hydroxy-4-(2-hydroxyethylamino)-5-methoxyphenyl]urea (PubChem CID 18006592) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-hydroxy-4-(2-hydroxyethylamino)-5-methoxyphenyl]urea.
| Compound Name | 1,1-diethyl-3-[2-hydroxy-4-(2-hydroxyethylamino)-5-methoxyphenyl]urea |
|---|---|
| PubChem CID | 18006592 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1,1-diethyl-3-[2-hydroxy-4-(2-hydroxyethylamino)-5-methoxyphenyl]urea |
| SMILES | CCN(CC)C(=O)Nc1cc(OC)c(NCCO)cc1O |
| InChI | InChI=1S/C14H23N3O4/c1-4-17(5-2)14(20)16-10-9-13(21-3)11(8-12(10)19)15-6-7-18/h8-9,15,18-19H,4-7H2,1-3H3,(H,16,20) |
| InChIKey | SMTLHCODEWBBIZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|