C13H19BrN2O4 — CID 47376181
3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyethyl)-1-methylurea (PubChem CID 47376181) has the molecular formula C13H19BrN2O4 and a molecular weight of 347.21 g/mol. Its IUPAC name is 3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyethyl)-1-methylurea.
| Compound Name | 3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyethyl)-1-methylurea |
|---|---|
| PubChem CID | 47376181 |
| Molecular Formula | C13H19BrN2O4 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 3-(2-bromo-4,5-dimethoxyphenyl)-1-(2-methoxyethyl)-1-methylurea |
| SMILES | COCCN(C)C(=O)Nc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C13H19BrN2O4/c1-16(5-6-18-2)13(17)15-10-8-12(20-4)11(19-3)7-9(10)14/h7-8H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | XCCLQEXUPHVPCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |