C12H16BrClN2O — CID 104724253
3-(2-bromo-5-chloro-4-methylphenyl)-1,1-diethylurea (PubChem CID 104724253) has the molecular formula C12H16BrClN2O and a molecular weight of 319.63 g/mol. Its IUPAC name is 3-(2-bromo-5-chloro-4-methylphenyl)-1,1-diethylurea.
| Compound Name | 3-(2-bromo-5-chloro-4-methylphenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 104724253 |
| Molecular Formula | C12H16BrClN2O |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-(2-bromo-5-chloro-4-methylphenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1cc(Cl)c(C)cc1Br |
| InChI | InChI=1S/C12H16BrClN2O/c1-4-16(5-2)12(17)15-11-7-10(14)8(3)6-9(11)13/h6-7H,4-5H2,1-3H3,(H,15,17) |
| InChIKey | JBLNWBYGJOIVMP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |