C10H7BrClNO — CID 104723899
N-(2-bromo-5-chloro-4-methylphenyl)prop-2-ynamide (PubChem CID 104723899) has the molecular formula C10H7BrClNO and a molecular weight of 272.53 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-4-methylphenyl)prop-2-ynamide.
| Compound Name | N-(2-bromo-5-chloro-4-methylphenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 104723899 |
| Molecular Formula | C10H7BrClNO |
| Molecular Weight | 272.53 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | N-(2-bromo-5-chloro-4-methylphenyl)prop-2-ynamide |
| SMILES | C#CC(=O)Nc1cc(Cl)c(C)cc1Br |
| InChI | InChI=1S/C10H7BrClNO/c1-3-10(14)13-9-5-8(12)6(2)4-7(9)11/h1,4-5H,2H3,(H,13,14) |
| InChIKey | JJETZTFBEAEMMC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|