C16H25F3N2 — CID 43587076
2-(aminomethyl)-N-ethyl-N-(2-ethylbutyl)-4-(trifluoromethyl)aniline (PubChem CID 43587076) has the molecular formula C16H25F3N2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-(aminomethyl)-N-ethyl-N-(2-ethylbutyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-(aminomethyl)-N-ethyl-N-(2-ethylbutyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43587076 |
| Molecular Formula | C16H25F3N2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-(aminomethyl)-N-ethyl-N-(2-ethylbutyl)-4-(trifluoromethyl)aniline |
| SMILES | CCC(CC)CN(CC)c1ccc(C(F)(F)F)cc1CN |
| InChI | InChI=1S/C16H25F3N2/c1-4-12(5-2)11-21(6-3)15-8-7-14(16(17,18)19)9-13(15)10-20/h7-9,12H,4-6,10-11,20H2,1-3H3 |
| InChIKey | FCHDDNDOTOGPQS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |