C12H15F3N2O3 — CID 62160495
4-amino-N,N-bis(2-hydroxyethyl)-3-(trifluoromethyl)benzamide (PubChem CID 62160495) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-hydroxyethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-amino-N,N-bis(2-hydroxyethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62160495 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-amino-N,N-bis(2-hydroxyethyl)-3-(trifluoromethyl)benzamide |
| SMILES | Nc1ccc(C(=O)N(CCO)CCO)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O3/c13-12(14,15)9-7-8(1-2-10(9)16)11(20)17(3-5-18)4-6-19/h1-2,7,18-19H,3-6,16H2 |
| InChIKey | JVTUCEUADTXENP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|