C11H14BrNO4 — CID 103957673
4-bromo-3-hydroxy-N,N-bis(2-hydroxyethyl)benzamide (PubChem CID 103957673) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 4-bromo-3-hydroxy-N,N-bis(2-hydroxyethyl)benzamide.
| Compound Name | 4-bromo-3-hydroxy-N,N-bis(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 103957673 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 4-bromo-3-hydroxy-N,N-bis(2-hydroxyethyl)benzamide |
| SMILES | O=C(c1ccc(Br)c(O)c1)N(CCO)CCO |
| InChI | InChI=1S/C11H14BrNO4/c12-9-2-1-8(7-10(9)16)11(17)13(3-5-14)4-6-15/h1-2,7,14-16H,3-6H2 |
| InChIKey | HQZOEAWECMKRHC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |