C15H16F3N5O3 — CID 23484167
2-[ethyl-[5-nitro-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]ethanol (PubChem CID 23484167) has the molecular formula C15H16F3N5O3 and a molecular weight of 371.32 g/mol. Its IUPAC name is 2-[ethyl-[5-nitro-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[ethyl-[5-nitro-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 23484167 |
| Molecular Formula | C15H16F3N5O3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[ethyl-[5-nitro-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]ethanol |
| SMILES | CCN(CCO)c1ncnc(Nc2ccccc2C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16F3N5O3/c1-2-22(7-8-24)14-12(23(25)26)13(19-9-20-14)21-11-6-4-3-5-10(11)15(16,17)18/h3-6,9,24H,2,7-8H2,1H3,(H,19,20,21) |
| InChIKey | HPFCZTWHZVYMGA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|