C15H15ClF3N5O2 — CID 23479615
6-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine (PubChem CID 23479615) has the molecular formula C15H15ClF3N5O2 and a molecular weight of 389.77 g/mol. Its IUPAC name is 6-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23479615 |
| Molecular Formula | C15H15ClF3N5O2 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 6-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N,4-N-diethyl-5-nitropyrimidine-4,6-diamine |
| SMILES | CCN(CC)c1ncnc(Nc2cc(C(F)(F)F)ccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15ClF3N5O2/c1-3-23(4-2)14-12(24(25)26)13(20-8-21-14)22-11-7-9(15(17,18)19)5-6-10(11)16/h5-8H,3-4H2,1-2H3,(H,20,21,22) |
| InChIKey | VBFNFRMTFBWILN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|