C20H15ClF3N5O4 — CID 23479783
methyl 2-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-methylamino]benzoate (PubChem CID 23479783) has the molecular formula C20H15ClF3N5O4 and a molecular weight of 481.82 g/mol. Its IUPAC name is methyl 2-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 23479783 |
| Molecular Formula | C20H15ClF3N5O4 |
| Molecular Weight | 481.82 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | methyl 2-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)c1ncnc(Nc2cc(C(F)(F)F)ccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15ClF3N5O4/c1-28(15-6-4-3-5-12(15)19(30)33-2)18-16(29(31)32)17(25-10-26-18)27-14-9-11(20(22,23)24)7-8-13(14)21/h3-10H,1-2H3,(H,25,26,27) |
| InChIKey | CVSYPYJZORGQEY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|