C22H21N5O6 — CID 22538222
methyl 2-[[6-(3-ethoxycarbonylanilino)-5-nitropyrimidin-4-yl]-methylamino]benzoate (PubChem CID 22538222) has the molecular formula C22H21N5O6 and a molecular weight of 451.44 g/mol. Its IUPAC name is methyl 2-[[6-(3-ethoxycarbonylanilino)-5-nitropyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[6-(3-ethoxycarbonylanilino)-5-nitropyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 22538222 |
| Molecular Formula | C22H21N5O6 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | methyl 2-[[6-(3-ethoxycarbonylanilino)-5-nitropyrimidin-4-yl]-methylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(N(C)c3ccccc3C(=O)OC)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H21N5O6/c1-4-33-21(28)14-8-7-9-15(12-14)25-19-18(27(30)31)20(24-13-23-19)26(2)17-11-6-5-10-16(17)22(29)32-3/h5-13H,4H2,1-3H3,(H,23,24,25) |
| InChIKey | PNTMVPNNRKSTIU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|