C17H9Cl3F3N5O2 — CID 23479681
4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23479681) has the molecular formula C17H9Cl3F3N5O2 and a molecular weight of 478.65 g/mol. Its IUPAC name is 4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23479681 |
| Molecular Formula | C17H9Cl3F3N5O2 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | 4-N-[2-chloro-5-(trifluoromethyl)phenyl]-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2cc(C(F)(F)F)ccc2Cl)ncnc1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H9Cl3F3N5O2/c18-9-5-4-8(17(21,22)23)6-12(9)27-16-14(28(29)30)15(24-7-25-16)26-11-3-1-2-10(19)13(11)20/h1-7H,(H2,24,25,26,27) |
| InChIKey | LBMWCBOUXMRBRM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|