C19H14ClF3N6O3 — CID 23479719
N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-4-methylbenzohydrazide (PubChem CID 23479719) has the molecular formula C19H14ClF3N6O3 and a molecular weight of 466.81 g/mol. Its IUPAC name is N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-4-methylbenzohydrazide.
| Compound Name | N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 23479719 |
| Molecular Formula | C19H14ClF3N6O3 |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2ncnc(Nc3cc(C(F)(F)F)ccc3Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14ClF3N6O3/c1-10-2-4-11(5-3-10)18(30)28-27-17-15(29(31)32)16(24-9-25-17)26-14-8-12(19(21,22)23)6-7-13(14)20/h2-9H,1H3,(H,28,30)(H2,24,25,26,27) |
| InChIKey | PKCFIWUNJFZKTE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|