C19H13ClF3N5O3 — CID 23479602
1-[3-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 23479602) has the molecular formula C19H13ClF3N5O3 and a molecular weight of 451.79 g/mol. Its IUPAC name is 1-[3-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 23479602 |
| Molecular Formula | C19H13ClF3N5O3 |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 1-[3-[[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ncnc(Nc3cc(C(F)(F)F)ccc3Cl)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13ClF3N5O3/c1-10(29)11-3-2-4-13(7-11)26-17-16(28(30)31)18(25-9-24-17)27-15-8-12(19(21,22)23)5-6-14(15)20/h2-9H,1H3,(H2,24,25,26,27) |
| InChIKey | VEPVZIPHCDGIGV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|