C14H15Cl2N5O3 — CID 23493137
2-[[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]-ethylamino]ethanol (PubChem CID 23493137) has the molecular formula C14H15Cl2N5O3 and a molecular weight of 372.21 g/mol. Its IUPAC name is 2-[[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]-ethylamino]ethanol.
| Compound Name | 2-[[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 23493137 |
| Molecular Formula | C14H15Cl2N5O3 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]-ethylamino]ethanol |
| SMILES | CCN(CCO)c1ncnc(Nc2cc(Cl)ccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15Cl2N5O3/c1-2-20(5-6-22)14-12(21(23)24)13(17-8-18-14)19-11-7-9(15)3-4-10(11)16/h3-4,7-8,22H,2,5-6H2,1H3,(H,17,18,19) |
| InChIKey | UGCROGWISPBZNF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|