C13H16N6O3 — CID 23481948
2-[ethyl-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]ethanol (PubChem CID 23481948) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[ethyl-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[ethyl-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 23481948 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[ethyl-[5-nitro-6-(pyridin-4-ylamino)pyrimidin-4-yl]amino]ethanol |
| SMILES | CCN(CCO)c1ncnc(Nc2ccncc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O3/c1-2-18(7-8-20)13-11(19(21)22)12(15-9-16-13)17-10-3-5-14-6-4-10/h3-6,9,20H,2,7-8H2,1H3,(H,14,15,16,17) |
| InChIKey | HPVRDSWNDOYDQB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|