C18H25N5O4 — CID 23482627
6-N-(2-ethylphenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23482627) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is 6-N-(2-ethylphenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-ethylphenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23482627 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 6-N-(2-ethylphenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCc1ccccc1Nc1ncnc(N(CCOC)CCOC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N5O4/c1-4-14-7-5-6-8-15(14)21-17-16(23(24)25)18(20-13-19-17)22(9-11-26-2)10-12-27-3/h5-8,13H,4,9-12H2,1-3H3,(H,19,20,21) |
| InChIKey | BOZQZATVEDAMKZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|