C16H20ClN5O4 — CID 23493662
6-N-(4-chlorophenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23493662) has the molecular formula C16H20ClN5O4 and a molecular weight of 381.82 g/mol. Its IUPAC name is 6-N-(4-chlorophenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-chlorophenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23493662 |
| Molecular Formula | C16H20ClN5O4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 6-N-(4-chlorophenyl)-4-N,4-N-bis(2-methoxyethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCCN(CCOC)c1ncnc(Nc2ccc(Cl)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20ClN5O4/c1-25-9-7-21(8-10-26-2)16-14(22(23)24)15(18-11-19-16)20-13-5-3-12(17)4-6-13/h3-6,11H,7-10H2,1-2H3,(H,18,19,20) |
| InChIKey | QEOXHOBBCYRAKO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|