C13H17FN2O3 — CID 80751861
4-(3-fluoro-5-nitrophenyl)-2,2,6-trimethylmorpholine (PubChem CID 80751861) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 4-(3-fluoro-5-nitrophenyl)-2,2,6-trimethylmorpholine.
| Compound Name | 4-(3-fluoro-5-nitrophenyl)-2,2,6-trimethylmorpholine |
|---|---|
| PubChem CID | 80751861 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 4-(3-fluoro-5-nitrophenyl)-2,2,6-trimethylmorpholine |
| SMILES | CC1CN(c2cc(F)cc([N+](=O)[O-])c2)CC(C)(C)O1 |
| InChI | InChI=1S/C13H17FN2O3/c1-9-7-15(8-13(2,3)19-9)11-4-10(14)5-12(6-11)16(17)18/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | WUMVSOSRTQCITG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|