About 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone
1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone (PubChem CID 115964112) has the molecular formula C13H18N2O4S
and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone |
| PubChem CID | 115964112 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(N2CC(C)OC(C)(C)C2)s1 |
| InChI | InChI=1S/C13H18N2O4S/c1-8-6-14(7-13(3,4)19-8)12-10(15(17)18)5-11(20-12)9(2)16/h5,8H,6-7H2,1-4H3 |
| InChIKey | YZTKHOUNUKDROV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone?
The IUPAC name of 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone (CID 115964112) is 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone.
What is the SMILES notation for 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone?
The canonical SMILES for 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone is CC(=O)c1cc([N+](=O)[O-])c(N2CC(C)OC(C)(C)C2)s1.
What is the InChIKey of 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone?
The InChIKey is YZTKHOUNUKDROV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4S/c1-8-6-14(7-13(3,4)19-8)12-10(15(17)18)5-11(20-12)9(2)16/h5,8H,6-7H2,1-4H3.
What are the key properties of 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone?
1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone has a molecular weight of 298.36 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-nitro-5-(2,2,6-trimethylmorpholin-4-yl)thiophen-2-yl]ethanone is sourced from PubChem (CID 115964112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).