C14H17N3O3 — CID 47430277
3-nitro-4-(2,2,6-trimethylmorpholin-4-yl)benzonitrile (PubChem CID 47430277) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-nitro-4-(2,2,6-trimethylmorpholin-4-yl)benzonitrile.
| Compound Name | 3-nitro-4-(2,2,6-trimethylmorpholin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 47430277 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-nitro-4-(2,2,6-trimethylmorpholin-4-yl)benzonitrile |
| SMILES | CC1CN(c2ccc(C#N)cc2[N+](=O)[O-])CC(C)(C)O1 |
| InChI | InChI=1S/C14H17N3O3/c1-10-8-16(9-14(2,3)20-10)12-5-4-11(7-15)6-13(12)17(18)19/h4-6,10H,8-9H2,1-3H3 |
| InChIKey | HMKHEABUZQODLV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|