C10H10F3NO4 — CID 174734605
1,6-dimethyl-2-nitro-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 174734605) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 1,6-dimethyl-2-nitro-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 1,6-dimethyl-2-nitro-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 174734605 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 1,6-dimethyl-2-nitro-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1C=C(C(F)(F)F)C=C([N+](=O)[O-])C1(C)C(=O)O |
| InChI | InChI=1S/C10H10F3NO4/c1-5-3-6(10(11,12)13)4-7(14(17)18)9(5,2)8(15)16/h3-5H,1-2H3,(H,15,16) |
| InChIKey | VRWYXAKRROPMLY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|