C8H3BrClF3N2O6 — CID 175785889
3-bromo-4-chloro-3,5-dinitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 175785889) has the molecular formula C8H3BrClF3N2O6 and a molecular weight of 395.47 g/mol. Its IUPAC name is 3-bromo-4-chloro-3,5-dinitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 3-bromo-4-chloro-3,5-dinitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 175785889 |
| Molecular Formula | C8H3BrClF3N2O6 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | 3-bromo-4-chloro-3,5-dinitro-4-(trifluoromethyl)cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(Br)([N+](=O)[O-])C(Cl)(C(F)(F)F)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C8H3BrClF3N2O6/c9-6(15(20)21)2-3(5(16)17)1-4(14(18)19)7(6,10)8(11,12)13/h1-2H,(H,16,17) |
| InChIKey | YTKRCVPACHXVSF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|