C5ClF5 — CID 14024623
5-chloro-1,2,3,4,5-pentafluorocyclopenta-1,3-diene (PubChem CID 14024623) has the molecular formula C5ClF5 and a molecular weight of 190.50 g/mol. Its IUPAC name is 5-chloro-1,2,3,4,5-pentafluorocyclopenta-1,3-diene.
| Compound Name | 5-chloro-1,2,3,4,5-pentafluorocyclopenta-1,3-diene |
|---|---|
| PubChem CID | 14024623 |
| Molecular Formula | C5ClF5 |
| Molecular Weight | 190.50 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 5-chloro-1,2,3,4,5-pentafluorocyclopenta-1,3-diene |
| SMILES | FC1=C(F)C(F)(Cl)C(F)=C1F |
| InChI | InChI=1S/C5ClF5/c6-5(11)3(9)1(7)2(8)4(5)10 |
| InChIKey | FSEXDGCKJWANEQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|