C10F18 — CID 139346859
(1Z)-1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-octadecafluorocyclodecene (PubChem CID 139346859) has the molecular formula C10F18 and a molecular weight of 462.07 g/mol. Its IUPAC name is (1Z)-1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-octadecafluorocyclodecene.
| Compound Name | (1Z)-1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-octadecafluorocyclodecene |
|---|---|
| PubChem CID | 139346859 |
| Molecular Formula | C10F18 |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | (1Z)-1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-octadecafluorocyclodecene |
| SMILES | F/C1=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F18/c11-1-2(12)4(15,16)6(19,20)8(23,24)10(27,28)9(25,26)7(21,22)5(17,18)3(1,13)14/b2-1- |
| InChIKey | VUEKDBOWUIJNFV-UPHRSURJSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|