C5HF7O — CID 15783600
2,3,3,4,4,5,5-heptafluorocyclopenten-1-ol (PubChem CID 15783600) has the molecular formula C5HF7O and a molecular weight of 210.05 g/mol. Its IUPAC name is 2,3,3,4,4,5,5-heptafluorocyclopenten-1-ol.
| Compound Name | 2,3,3,4,4,5,5-heptafluorocyclopenten-1-ol |
|---|---|
| PubChem CID | 15783600 |
| Molecular Formula | C5HF7O |
| Molecular Weight | 210.05 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 2,3,3,4,4,5,5-heptafluorocyclopenten-1-ol |
| SMILES | OC1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5HF7O/c6-1-2(13)4(9,10)5(11,12)3(1,7)8/h13H |
| InChIKey | WIQKJUYNBLZQSU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.05 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|