C6H3F7I- — CID 169017999
1,3,3,4,4,5,5-heptafluoro-2-methyliodanuidylcyclopentene (PubChem CID 169017999) has the molecular formula C6H3F7I- and a molecular weight of 334.98 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-methyliodanuidylcyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-methyliodanuidylcyclopentene |
|---|---|
| PubChem CID | 169017999 |
| Molecular Formula | C6H3F7I- |
| Molecular Weight | 334.98 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-methyliodanuidylcyclopentene |
| SMILES | C[I-]C1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H3F7I/c1-14-3-2(7)4(8,9)6(12,13)5(3,10)11/h1H3/q-1 |
| InChIKey | VTXPECVKEVZFKC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.98 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|