C6F10O — CID 134245341
1,3,3,4,4,5,5-heptafluoro-2-(trifluoromethoxy)cyclopentene (PubChem CID 134245341) has the molecular formula C6F10O and a molecular weight of 278.05 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-(trifluoromethoxy)cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-(trifluoromethoxy)cyclopentene |
|---|---|
| PubChem CID | 134245341 |
| Molecular Formula | C6F10O |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-(trifluoromethoxy)cyclopentene |
| SMILES | FC1=C(OC(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6F10O/c7-1-2(17-6(14,15)16)4(10,11)5(12,13)3(1,8)9 |
| InChIKey | DKACIBCFSKOUDE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|