C15H11F7O2 — CID 122554586
1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxy-2-methoxy-4-prop-2-enylbenzene (PubChem CID 122554586) has the molecular formula C15H11F7O2 and a molecular weight of 356.24 g/mol. Its IUPAC name is 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxy-2-methoxy-4-prop-2-enylbenzene.
| Compound Name | 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxy-2-methoxy-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 122554586 |
| Molecular Formula | C15H11F7O2 |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)oxy-2-methoxy-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(OC2=C(F)C(F)(F)C(F)(F)C2(F)F)c(OC)c1 |
| InChI | InChI=1S/C15H11F7O2/c1-3-4-8-5-6-9(10(7-8)23-2)24-12-11(16)13(17,18)15(21,22)14(12,19)20/h3,5-7H,1,4H2,2H3 |
| InChIKey | JGQLOTDVKRYQEV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|