C6F10O2 — CID 87774570
2,2,3,3,5,6,6-heptafluoro-4-(trifluoromethoxy)pyran (PubChem CID 87774570) has the molecular formula C6F10O2 and a molecular weight of 294.04 g/mol. Its IUPAC name is 2,2,3,3,5,6,6-heptafluoro-4-(trifluoromethoxy)pyran.
| Compound Name | 2,2,3,3,5,6,6-heptafluoro-4-(trifluoromethoxy)pyran |
|---|---|
| PubChem CID | 87774570 |
| Molecular Formula | C6F10O2 |
| Molecular Weight | 294.04 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 2,2,3,3,5,6,6-heptafluoro-4-(trifluoromethoxy)pyran |
| SMILES | FC1=C(OC(F)(F)F)C(F)(F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C6F10O2/c7-1-2(17-6(14,15)16)3(8,9)5(12,13)18-4(1,10)11 |
| InChIKey | MBKJZGORWXFYIC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.04 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|