C5F8O3S — CID 10851163
(1,2,3,4,4-pentafluorocyclobut-2-en-1-yl) trifluoromethanesulfonate (PubChem CID 10851163) has the molecular formula C5F8O3S and a molecular weight of 292.10 g/mol. Its IUPAC name is (1,2,3,4,4-pentafluorocyclobut-2-en-1-yl) trifluoromethanesulfonate.
| Compound Name | (1,2,3,4,4-pentafluorocyclobut-2-en-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10851163 |
| Molecular Formula | C5F8O3S |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | (1,2,3,4,4-pentafluorocyclobut-2-en-1-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1(F)C(F)=C(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C5F8O3S/c6-1-2(7)4(10,3(1,8)9)16-17(14,15)5(11,12)13 |
| InChIKey | BBJKYECWLVFABK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|