C6ClF11O3S — CID 12599137
(2-chloro-1,2,3,3,4,4,5,5-octafluorocyclopentyl) trifluoromethanesulfonate (PubChem CID 12599137) has the molecular formula C6ClF11O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is (2-chloro-1,2,3,3,4,4,5,5-octafluorocyclopentyl) trifluoromethanesulfonate.
| Compound Name | (2-chloro-1,2,3,3,4,4,5,5-octafluorocyclopentyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12599137 |
| Molecular Formula | C6ClF11O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 395.91 |
| IUPAC Name | (2-chloro-1,2,3,3,4,4,5,5-octafluorocyclopentyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)Cl)C(F)(F)F |
| InChI | InChI=1S/C6ClF11O3S/c7-1(8)2(9,10)3(11,12)4(13,14)5(1,15)21-22(19,20)6(16,17)18 |
| InChIKey | RKBZUBAALOLGJT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|