C7ClF13 — CID 139815776
1-chloro-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptane (PubChem CID 139815776) has the molecular formula C7ClF13 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-chloro-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptane.
| Compound Name | 1-chloro-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptane |
|---|---|
| PubChem CID | 139815776 |
| Molecular Formula | C7ClF13 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 1-chloro-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorocycloheptane |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Cl)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7ClF13/c8-1(9)2(10,11)4(14,15)6(18,19)7(20,21)5(16,17)3(1,12)13 |
| InChIKey | JOOHGCPHSIZEAR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|