C6Cl4F6 — CID 175040926
3,4,5,6-tetrachloro-1,2,3,4,5,6-hexafluorocyclohexene (PubChem CID 175040926) has the molecular formula C6Cl4F6 and a molecular weight of 327.87 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-1,2,3,4,5,6-hexafluorocyclohexene.
| Compound Name | 3,4,5,6-tetrachloro-1,2,3,4,5,6-hexafluorocyclohexene |
|---|---|
| PubChem CID | 175040926 |
| Molecular Formula | C6Cl4F6 |
| Molecular Weight | 327.87 g/mol |
| Exact Mass | 325.87 |
| IUPAC Name | 3,4,5,6-tetrachloro-1,2,3,4,5,6-hexafluorocyclohexene |
| SMILES | FC1=C(F)C(F)(Cl)C(F)(Cl)C(F)(Cl)C1(F)Cl |
| InChI | InChI=1S/C6Cl4F6/c7-3(13)1(11)2(12)4(8,14)6(10,16)5(3,9)15 |
| InChIKey | CFMKPEQPCGJBLR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|