C4ClF5O — CID 160731078
3-chloro-2,2,3,4,4-pentafluorocyclobutan-1-one (PubChem CID 160731078) has the molecular formula C4ClF5O and a molecular weight of 194.49 g/mol. Its IUPAC name is 3-chloro-2,2,3,4,4-pentafluorocyclobutan-1-one.
| Compound Name | 3-chloro-2,2,3,4,4-pentafluorocyclobutan-1-one |
|---|---|
| PubChem CID | 160731078 |
| Molecular Formula | C4ClF5O |
| Molecular Weight | 194.49 g/mol |
| Exact Mass | 193.96 |
| IUPAC Name | 3-chloro-2,2,3,4,4-pentafluorocyclobutan-1-one |
| SMILES | O=C1C(F)(F)C(F)(Cl)C1(F)F |
| InChI | InChI=1S/C4ClF5O/c5-4(10)2(6,7)1(11)3(4,8)9 |
| InChIKey | RUIQMJIMLWWIMC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|