C4Cl3F3O — CID 154384939
2,2,4-trichloro-3,3,4-trifluorocyclobutan-1-one (PubChem CID 154384939) has the molecular formula C4Cl3F3O and a molecular weight of 227.40 g/mol. Its IUPAC name is 2,2,4-trichloro-3,3,4-trifluorocyclobutan-1-one.
| Compound Name | 2,2,4-trichloro-3,3,4-trifluorocyclobutan-1-one |
|---|---|
| PubChem CID | 154384939 |
| Molecular Formula | C4Cl3F3O |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 225.90 |
| IUPAC Name | 2,2,4-trichloro-3,3,4-trifluorocyclobutan-1-one |
| SMILES | O=C1C(F)(Cl)C(F)(F)C1(Cl)Cl |
| InChI | InChI=1S/C4Cl3F3O/c5-2(6)1(11)3(7,8)4(2,9)10 |
| InChIKey | KJBSSCNRJCISHG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|