C4Cl2F4O — CID 154123146
3,3-dichloro-2,2,4,4-tetrafluorocyclobutan-1-one (PubChem CID 154123146) has the molecular formula C4Cl2F4O and a molecular weight of 210.94 g/mol. Its IUPAC name is 3,3-dichloro-2,2,4,4-tetrafluorocyclobutan-1-one.
| Compound Name | 3,3-dichloro-2,2,4,4-tetrafluorocyclobutan-1-one |
|---|---|
| PubChem CID | 154123146 |
| Molecular Formula | C4Cl2F4O |
| Molecular Weight | 210.94 g/mol |
| Exact Mass | 209.93 |
| IUPAC Name | 3,3-dichloro-2,2,4,4-tetrafluorocyclobutan-1-one |
| SMILES | O=C1C(F)(F)C(Cl)(Cl)C1(F)F |
| InChI | InChI=1S/C4Cl2F4O/c5-4(6)2(7,8)1(11)3(4,9)10 |
| InChIKey | LUQYSBYKOAYGTB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.94 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|