C5H4ClF3 — CID 141084746
3-chloro-1,2,3-trifluorocyclopentene (PubChem CID 141084746) has the molecular formula C5H4ClF3 and a molecular weight of 156.53 g/mol. Its IUPAC name is 3-chloro-1,2,3-trifluorocyclopentene.
| Compound Name | 3-chloro-1,2,3-trifluorocyclopentene |
|---|---|
| PubChem CID | 141084746 |
| Molecular Formula | C5H4ClF3 |
| Molecular Weight | 156.53 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | 3-chloro-1,2,3-trifluorocyclopentene |
| SMILES | FC1=C(F)C(F)(Cl)CC1 |
| InChI | InChI=1S/C5H4ClF3/c6-5(9)2-1-3(7)4(5)8/h1-2H2 |
| InChIKey | MHMDFYBPCMMPQP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|