C5H3ClF6 — CID 21279835
1-chloro-1,2,2,3,3,4-hexafluoro-4-methylcyclobutane (PubChem CID 21279835) has the molecular formula C5H3ClF6 and a molecular weight of 212.52 g/mol. Its IUPAC name is 1-chloro-1,2,2,3,3,4-hexafluoro-4-methylcyclobutane.
| Compound Name | 1-chloro-1,2,2,3,3,4-hexafluoro-4-methylcyclobutane |
|---|---|
| PubChem CID | 21279835 |
| Molecular Formula | C5H3ClF6 |
| Molecular Weight | 212.52 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 1-chloro-1,2,2,3,3,4-hexafluoro-4-methylcyclobutane |
| SMILES | CC1(F)C(F)(F)C(F)(F)C1(F)Cl |
| InChI | InChI=1S/C5H3ClF6/c1-2(7)3(6,8)5(11,12)4(2,9)10/h1H3 |
| InChIKey | XUPZOAHZXITDCN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|