C15H3F23 — CID 59941574
1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8a,9,9,10,10,10a-tricosafluoro-8-methylphenanthrene (PubChem CID 59941574) has the molecular formula C15H3F23 and a molecular weight of 620.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8a,9,9,10,10,10a-tricosafluoro-8-methylphenanthrene.
| Compound Name | 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8a,9,9,10,10,10a-tricosafluoro-8-methylphenanthrene |
|---|---|
| PubChem CID | 59941574 |
| Molecular Formula | C15H3F23 |
| Molecular Weight | 620.14 g/mol |
| Exact Mass | 619.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8a,9,9,10,10,10a-tricosafluoro-8-methylphenanthrene |
| SMILES | CC1(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C1(F)C(F)(F)C(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F |
| InChI | InChI=1S/C15H3F23/c1-2(16)3(17)4(18,9(25,26)13(33,34)7(2,21)22)5(19)6(20,11(29,30)8(3,23)24)12(31,32)15(37,38)14(35,36)10(5,27)28/h1H3 |
| InChIKey | INTWKAJTCOKAEZ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.14 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|