C11H3F17 — CID 98117240
(4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-methylnaphthalene (PubChem CID 98117240) has the molecular formula C11H3F17 and a molecular weight of 458.11 g/mol. Its IUPAC name is (4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-methylnaphthalene.
| Compound Name | (4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-methylnaphthalene |
|---|---|
| PubChem CID | 98117240 |
| Molecular Formula | C11H3F17 |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | (4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-methylnaphthalene |
| SMILES | C[C@@]1(F)C(F)(F)C(F)(F)C(F)(F)[C@@]2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[C@@]21F |
| InChI | InChI=1S/C11H3F17/c1-2(12)3(13)4(14,7(19,20)9(23,24)5(2,15)16)8(21,22)11(27,28)10(25,26)6(3,17)18/h1H3/t2-,3-,4+/m0/s1 |
| InChIKey | UFJBZZBHLIAIBE-YVZJFKFKSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|