C8H6Cl2F8 — CID 141455516
1,2-dichloro-1,2,3,4,4,5,5,6-octafluoro-3,6-dimethylcyclohexane (PubChem CID 141455516) has the molecular formula C8H6Cl2F8 and a molecular weight of 325.03 g/mol. Its IUPAC name is 1,2-dichloro-1,2,3,4,4,5,5,6-octafluoro-3,6-dimethylcyclohexane.
| Compound Name | 1,2-dichloro-1,2,3,4,4,5,5,6-octafluoro-3,6-dimethylcyclohexane |
|---|---|
| PubChem CID | 141455516 |
| Molecular Formula | C8H6Cl2F8 |
| Molecular Weight | 325.03 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 1,2-dichloro-1,2,3,4,4,5,5,6-octafluoro-3,6-dimethylcyclohexane |
| SMILES | CC1(F)C(F)(F)C(F)(F)C(C)(F)C(F)(Cl)C1(F)Cl |
| InChI | InChI=1S/C8H6Cl2F8/c1-3(11)5(9,13)6(10,14)4(2,12)8(17,18)7(3,15)16/h1-2H3 |
| InChIKey | HDVZEMVHZYFWTF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.03 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|