C4F14S — CID 174484392
hexafluoro-λ6-sulfane;1,1,2,2,3,3,4,4-octafluorocyclobutane (PubChem CID 174484392) has the molecular formula C4F14S and a molecular weight of 346.08 g/mol. Its IUPAC name is hexafluoro-λ6-sulfane;1,1,2,2,3,3,4,4-octafluorocyclobutane.
| Compound Name | hexafluoro-λ6-sulfane;1,1,2,2,3,3,4,4-octafluorocyclobutane |
|---|---|
| PubChem CID | 174484392 |
| Molecular Formula | C4F14S |
| Molecular Weight | 346.08 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | hexafluoro-λ6-sulfane;1,1,2,2,3,3,4,4-octafluorocyclobutane |
| SMILES | FC1(F)C(F)(F)C(F)(F)C1(F)F.FS(F)(F)(F)(F)F |
| InChI | InChI=1S/C4F8.F6S/c5-1(6)2(7,8)4(11,12)3(1,9)10;1-7(2,3,4,5)6 |
| InChIKey | ADDOBTQLUZHPQH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.08 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|