C7F14 — CID 10247271
1,1,2,2,3,3,4,5-octafluoro-4,5-bis(trifluoromethyl)cyclopentane (PubChem CID 10247271) has the molecular formula C7F14 and a molecular weight of 350.05 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5-octafluoro-4,5-bis(trifluoromethyl)cyclopentane.
| Compound Name | 1,1,2,2,3,3,4,5-octafluoro-4,5-bis(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 10247271 |
| Molecular Formula | C7F14 |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1,1,2,2,3,3,4,5-octafluoro-4,5-bis(trifluoromethyl)cyclopentane |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)C(F)(F)F |
| InChI | InChI=1S/C7F14/c8-1(6(16,17)18)2(9,7(19,20)21)4(12,13)5(14,15)3(1,10)11 |
| InChIKey | IIGBPQRTNFGIOU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|