C10F20 — CID 98047723
trans-(4S,6S)-1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane (PubChem CID 98047723) has the molecular formula C10F20 and a molecular weight of 500.07 g/mol. Its IUPAC name is trans-(4S,6S)-1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane.
| Compound Name | trans-(4S,6S)-1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane |
|---|---|
| PubChem CID | 98047723 |
| Molecular Formula | C10F20 |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | trans-(4S,6S)-1,1,2,2,3,3,4,5,5,6-decafluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)cyclohexane |
| SMILES | FC(F)(F)C(F)(F)[C@@]1(F)C(F)(F)C(F)(F)C(F)(F)[C@](F)(C(F)(F)C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C10F20/c11-1(6(19,20)9(25,26)27)3(13,14)2(12,7(21,22)10(28,29)30)5(17,18)8(23,24)4(1,15)16/t1-,2-/m0/s1 |
| InChIKey | OIWXSBDFHALUCH-LWMBPPNESA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|