C9F18 — CID 87754680
1,1,2,2,3,3,4,4,5,5-decafluoro-6-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)cyclohexane (PubChem CID 87754680) has the molecular formula C9F18 and a molecular weight of 450.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluoro-6-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-6-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 87754680 |
| Molecular Formula | C9F18 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-6-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)cyclohexane |
| SMILES | FC(F)(F)C(F)(F)C1(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9F18/c10-2(11)1(8(22,23)24,4(14,15)9(25,26)27)3(12,13)6(18,19)7(20,21)5(2,16)17 |
| InChIKey | REHHGZZVDMKGNA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|