C14F26 — CID 97291011
(4aS,6S,7S,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,7,8,8a-pentadecafluoro-8-(1,1,2,2,2-pentafluoroethyl)-6,7-bis(trifluoromethyl)naphthalene (PubChem CID 97291011) has the molecular formula C14F26 and a molecular weight of 662.10 g/mol. Its IUPAC name is (4aS,6S,7S,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,7,8,8a-pentadecafluoro-8-(1,1,2,2,2-pentafluoroethyl)-6,7-bis(trifluoromethyl)naphthalene.
| Compound Name | (4aS,6S,7S,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,7,8,8a-pentadecafluoro-8-(1,1,2,2,2-pentafluoroethyl)-6,7-bis(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 97291011 |
| Molecular Formula | C14F26 |
| Molecular Weight | 662.10 g/mol |
| Exact Mass | 661.96 |
| IUPAC Name | (4aS,6S,7S,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,7,8,8a-pentadecafluoro-8-(1,1,2,2,2-pentafluoroethyl)-6,7-bis(trifluoromethyl)naphthalene |
| SMILES | FC(F)(F)C(F)(F)[C@@]1(F)[C@@](F)(C(F)(F)F)[C@@](F)(C(F)(F)F)C(F)(F)[C@]2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[C@@]21F |
| InChI | InChI=1S/C14F26/c15-1(9(26,27)14(38,39)40)2(16)4(18,8(24,25)11(30,31)10(28,29)7(2,22)23)6(20,21)5(19,13(35,36)37)3(1,17)12(32,33)34/t1-,2-,3-,4-,5-/m0/s1 |
| InChIKey | YSROAMWJNUETQB-RCBNBJTQSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.10 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|