C11F20 — CID 76965926
(4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene (PubChem CID 76965926) has the molecular formula C11F20 and a molecular weight of 512.08 g/mol. Its IUPAC name is (4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene.
| Compound Name | (4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 76965926 |
| Molecular Formula | C11F20 |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | (4aR,8S,8aS)-1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene |
| SMILES | FC1(F)C(F)(F)C(F)(F)[C@]2(F)[C@](F)(C1(F)F)C(F)(F)C(F)(F)C(F)(F)[C@]2(F)C(F)(F)F |
| InChI | InChI=1S/C11F20/c12-1-2(13,6(19,20)10(27,28)9(25,26)4(1,15)16)5(17,18)8(23,24)7(21,22)3(1,14)11(29,30)31/t1-,2+,3-/m0/s1 |
| InChIKey | LWRNQOBXRHWPGE-MGGFGJSXSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|